About 5-fluoropyridine-3-carboxylic acid;(5-fluoro-3-pyridinyl)methanol
5-fluoropyridine-3-carboxylic acid;(5-fluoro-3-pyridinyl)methanol (PubChem CID 21128394) has the molecular formula C12H10F2N2O3
and a molecular weight of 268.22 g/mol. Its IUPAC name is 5-fluoropyridine-3-carboxylic acid;(5-fluoro-3-pyridinyl)methanol.
Molecular Properties
| Compound Name | 5-fluoropyridine-3-carboxylic acid;(5-fluoro-3-pyridinyl)methanol |
| PubChem CID | 21128394 |
| Molecular Formula | C12H10F2N2O3 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 5-fluoropyridine-3-carboxylic acid;(5-fluoro-3-pyridinyl)methanol |
| SMILES | O=C(O)c1cncc(F)c1.OCc1cncc(F)c1 |
| InChI | InChI=1S/C6H4FNO2.C6H6FNO/c7-5-1-4(6(9)10)2-8-3-5;7-6-1-5(4-9)2-8-3-6/h1-3H,(H,9,10);1-3,9H,4H2 |
| InChIKey | RSLSRSOBSQQJSC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoropyridine-3-carboxylic acid;(5-fluoro-3-pyridinyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoropyridine-3-carboxylic acid;(5-fluoro-3-pyridinyl)methanol?
The IUPAC name of 5-fluoropyridine-3-carboxylic acid;(5-fluoro-3-pyridinyl)methanol (CID 21128394) is 5-fluoropyridine-3-carboxylic acid;(5-fluoro-3-pyridinyl)methanol.
What is the SMILES notation for 5-fluoropyridine-3-carboxylic acid;(5-fluoro-3-pyridinyl)methanol?
The canonical SMILES for 5-fluoropyridine-3-carboxylic acid;(5-fluoro-3-pyridinyl)methanol is O=C(O)c1cncc(F)c1.OCc1cncc(F)c1.
What is the InChIKey of 5-fluoropyridine-3-carboxylic acid;(5-fluoro-3-pyridinyl)methanol?
The InChIKey is RSLSRSOBSQQJSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4FNO2.C6H6FNO/c7-5-1-4(6(9)10)2-8-3-5;7-6-1-5(4-9)2-8-3-6/h1-3H,(H,9,10);1-3,9H,4H2.
What are the key properties of 5-fluoropyridine-3-carboxylic acid;(5-fluoro-3-pyridinyl)methanol?
5-fluoropyridine-3-carboxylic acid;(5-fluoro-3-pyridinyl)methanol has a molecular weight of 268.22 g/mol, XLogP of 1.63, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoropyridine-3-carboxylic acid;(5-fluoro-3-pyridinyl)methanol is sourced from PubChem (CID 21128394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).