C9H17NO2S2 — CID 21128560
trans-(1R,2S)-2-(2-aminoethyldisulfanyl)cyclohexane-1-carboxylic acid (PubChem CID 21128560) has the molecular formula C9H17NO2S2 and a molecular weight of 235.37 g/mol. Its IUPAC name is trans-(1R,2S)-2-(2-aminoethyldisulfanyl)cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1R,2S)-2-(2-aminoethyldisulfanyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 21128560 |
| Molecular Formula | C9H17NO2S2 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | trans-(1R,2S)-2-(2-aminoethyldisulfanyl)cyclohexane-1-carboxylic acid |
| SMILES | NCCSS[C@H]1CCCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C9H17NO2S2/c10-5-6-13-14-8-4-2-1-3-7(8)9(11)12/h7-8H,1-6,10H2,(H,11,12)/t7-,8-/m0/s1 |
| InChIKey | CILZKOBQLDTNHQ-YUMQZZPRSA-N |
| XLogP | 1.97 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|