C8H19N3O5S — CID 21128698
2-[3-(oxolan-2-yl)propyl]guanidine;sulfuric acid (PubChem CID 21128698) has the molecular formula C8H19N3O5S and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-[3-(oxolan-2-yl)propyl]guanidine;sulfuric acid.
| Compound Name | 2-[3-(oxolan-2-yl)propyl]guanidine;sulfuric acid |
|---|---|
| PubChem CID | 21128698 |
| Molecular Formula | C8H19N3O5S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 2-[3-(oxolan-2-yl)propyl]guanidine;sulfuric acid |
| SMILES | NC(N)=NCCCC1CCCO1.O=S(=O)(O)O |
| InChI | InChI=1S/C8H17N3O.H2O4S/c9-8(10)11-5-1-3-7-4-2-6-12-7;1-5(2,3)4/h7H,1-6H2,(H4,9,10,11);(H2,1,2,3,4) |
| InChIKey | WJHMAKKYNJPWCV-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|