C7H16N2O4S3 — CID 21129019
N'-(oxolan-2-ylmethyl)-2-sulfanylethanimidamide;sulfurothioic O-acid (PubChem CID 21129019) has the molecular formula C7H16N2O4S3 and a molecular weight of 288.42 g/mol. Its IUPAC name is N'-(oxolan-2-ylmethyl)-2-sulfanylethanimidamide;sulfurothioic O-acid.
| Compound Name | N'-(oxolan-2-ylmethyl)-2-sulfanylethanimidamide;sulfurothioic O-acid |
|---|---|
| PubChem CID | 21129019 |
| Molecular Formula | C7H16N2O4S3 |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | N'-(oxolan-2-ylmethyl)-2-sulfanylethanimidamide;sulfurothioic O-acid |
| SMILES | N/C(CS)=N/CC1CCCO1.O=S(O)(O)=S |
| InChI | InChI=1S/C7H14N2OS.H2O3S2/c8-7(5-11)9-4-6-2-1-3-10-6;1-5(2,3)4/h6,11H,1-5H2,(H2,8,9);(H2,1,2,3,4) |
| InChIKey | CSDZWGJWUKJRAJ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|