C10H17F2N3O — CID 120514514
1-(3,3-difluorocyclobutyl)-2-(oxolan-2-ylmethyl)guanidine (PubChem CID 120514514) has the molecular formula C10H17F2N3O and a molecular weight of 233.26 g/mol. Its IUPAC name is 1-(3,3-difluorocyclobutyl)-2-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 1-(3,3-difluorocyclobutyl)-2-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 120514514 |
| Molecular Formula | C10H17F2N3O |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 1-(3,3-difluorocyclobutyl)-2-(oxolan-2-ylmethyl)guanidine |
| SMILES | N/C(=N\CC1CCCO1)NC1CC(F)(F)C1 |
| InChI | InChI=1S/C10H17F2N3O/c11-10(12)4-7(5-10)15-9(13)14-6-8-2-1-3-16-8/h7-8H,1-6H2,(H3,13,14,15) |
| InChIKey | VWCDBLDKGFZEEJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|