C11H20IN3O — CID 122125944
2-(oxolan-2-ylmethyl)-1-spiro[2.2]pentan-2-ylguanidine;hydroiodide (PubChem CID 122125944) has the molecular formula C11H20IN3O and a molecular weight of 337.21 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethyl)-1-spiro[2.2]pentan-2-ylguanidine;hydroiodide.
| Compound Name | 2-(oxolan-2-ylmethyl)-1-spiro[2.2]pentan-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 122125944 |
| Molecular Formula | C11H20IN3O |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-(oxolan-2-ylmethyl)-1-spiro[2.2]pentan-2-ylguanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1CCCO1)NC1CC12CC2 |
| InChI | InChI=1S/C11H19N3O.HI/c12-10(13-7-8-2-1-5-15-8)14-9-6-11(9)3-4-11;/h8-9H,1-7H2,(H3,12,13,14);1H |
| InChIKey | ZRYAXZRWLREEOW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|