C35H31N2OS2+ — CID 21131430
2-[(1E,3E,5E,7Z)-7-(3-ethyl-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]-3-(2-naphthalen-2-yloxyethyl)-1,3-benzothiazol-3-ium (PubChem CID 21131430) has the molecular formula C35H31N2OS2+ and a molecular weight of 559.78 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7Z)-7-(3-ethyl-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]-3-(2-naphthalen-2-yloxyethyl)-1,3-benzothiazol-3-ium.
| Compound Name | 2-[(1E,3E,5E,7Z)-7-(3-ethyl-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]-3-(2-naphthalen-2-yloxyethyl)-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 21131430 |
| Molecular Formula | C35H31N2OS2+ |
| Molecular Weight | 559.78 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 2-[(1E,3E,5E,7Z)-7-(3-ethyl-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]-3-(2-naphthalen-2-yloxyethyl)-1,3-benzothiazol-3-ium |
| SMILES | CCN1/C(=C/C=C/C=C/C=C/c2sc3ccccc3[n+]2CCOc2ccc3ccccc3c2)Sc2ccccc21 |
| InChI | InChI=1S/C35H31N2OS2/c1-2-36-30-16-10-12-18-32(30)39-34(36)20-6-4-3-5-7-21-35-37(31-17-11-13-19-33(31)40-35)24-25-38-29-23-22-27-14-8-9-15-28(27)26-29/h3-23,26H,2,24-25H2,1H3/q+1 |
| InChIKey | ZFRLFPDBXFDRDQ-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.78 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|