C22H29ClN2O2S — CID 49860336
3-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]-N,N-diethylpropan-1-amine;hydrate;hydrochloride (PubChem CID 49860336) has the molecular formula C22H29ClN2O2S and a molecular weight of 421.00 g/mol. Its IUPAC name is 3-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]-N,N-diethylpropan-1-amine;hydrate;hydrochloride.
| Compound Name | 3-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]-N,N-diethylpropan-1-amine;hydrate;hydrochloride |
|---|---|
| PubChem CID | 49860336 |
| Molecular Formula | C22H29ClN2O2S |
| Molecular Weight | 421.00 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 3-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]-N,N-diethylpropan-1-amine;hydrate;hydrochloride |
| SMILES | CCN(CC)CCCOC1=CC=C(C=C1)/C=C/C2=NC3=CC=CC=C3S2.O.Cl |
| InChI | InChI=1S/C22H26N2OS.ClH.H2O/c1-3-24(4-2)16-7-17-25-19-13-10-18(11-14-19)12-15-22-23-20-8-5-6-9-21(20)26-22;;/h5-6,8-15H,3-4,7,16-17H2,1-2H3;1H;1H2/b15-12+;; |
| InChIKey | ARFSNVNYOLJZLO-BXHFOUFMSA-N |
| XLogP | — |
| TPSA | 54.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | 418 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|