C9H17NS — CID 21132332
7,9-dimethyl-3-thia-9-azabicyclo[3.3.1]nonane (PubChem CID 21132332) has the molecular formula C9H17NS and a molecular weight of 171.31 g/mol. Its IUPAC name is 7,9-dimethyl-3-thia-9-azabicyclo[3.3.1]nonane.
| Compound Name | 7,9-dimethyl-3-thia-9-azabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 21132332 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 7,9-dimethyl-3-thia-9-azabicyclo[3.3.1]nonane |
| SMILES | CC1CC2CSCC(C1)N2C |
| InChI | InChI=1S/C9H17NS/c1-7-3-8-5-11-6-9(4-7)10(8)2/h7-9H,3-6H2,1-2H3 |
| InChIKey | FZWUNQIACJEZMF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |