C11H22NS+ — CID 91494378
9,9-dimethyl-1-thia-9-azoniaspiro[5.5]undecane (PubChem CID 91494378) has the molecular formula C11H22NS+ and a molecular weight of 200.37 g/mol. Its IUPAC name is 9,9-dimethyl-1-thia-9-azoniaspiro[5.5]undecane.
| Compound Name | 9,9-dimethyl-1-thia-9-azoniaspiro[5.5]undecane |
|---|---|
| PubChem CID | 91494378 |
| Molecular Formula | C11H22NS+ |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 9,9-dimethyl-1-thia-9-azoniaspiro[5.5]undecane |
| SMILES | C[N+]1(C)CCC2(CCCCS2)CC1 |
| InChI | InChI=1S/C11H22NS/c1-12(2)8-6-11(7-9-12)5-3-4-10-13-11/h3-10H2,1-2H3/q+1 |
| InChIKey | FWTUCXNPSZCFNJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|