C12H20N2O2 — CID 21132592
3-ethyl-1-propan-2-yl-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 21132592) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-ethyl-1-propan-2-yl-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-ethyl-1-propan-2-yl-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 21132592 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 3-ethyl-1-propan-2-yl-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | CCN1C(=O)N(C(C)C)C2(CCCC2)C1=O |
| InChI | InChI=1S/C12H20N2O2/c1-4-13-10(15)12(7-5-6-8-12)14(9(2)3)11(13)16/h9H,4-8H2,1-3H3 |
| InChIKey | CFEBIIUVBOAIBI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|