C18H17NS — CID 21135872
5,7-dimethyl-3-(4-methylphenyl)-1H-quinoline-2-thione (PubChem CID 21135872) has the molecular formula C18H17NS and a molecular weight of 279.41 g/mol. Its IUPAC name is 5,7-dimethyl-3-(4-methylphenyl)-1H-quinoline-2-thione.
| Compound Name | 5,7-dimethyl-3-(4-methylphenyl)-1H-quinoline-2-thione |
|---|---|
| PubChem CID | 21135872 |
| Molecular Formula | C18H17NS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 5,7-dimethyl-3-(4-methylphenyl)-1H-quinoline-2-thione |
| SMILES | Cc1ccc(-c2cc3c(C)cc(C)cc3[nH]c2=S)cc1 |
| InChI | InChI=1S/C18H17NS/c1-11-4-6-14(7-5-11)16-10-15-13(3)8-12(2)9-17(15)19-18(16)20/h4-10H,1-3H3,(H,19,20) |
| InChIKey | QSTKJMOAIFYFKA-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|