C22H30O2 — CID 21136915
(1-methylcyclohex-2-en-1-yl) 4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 21136915) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is (1-methylcyclohex-2-en-1-yl) 4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | (1-methylcyclohex-2-en-1-yl) 4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 21136915 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (1-methylcyclohex-2-en-1-yl) 4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | CC1C2CC(C3C4C=CC(C4)C23)C1(C)C(=O)OC1(C)C=CCCC1 |
| InChI | InChI=1S/C22H30O2/c1-13-16-12-17(19-15-8-7-14(11-15)18(16)19)22(13,3)20(23)24-21(2)9-5-4-6-10-21/h5,7-9,13-19H,4,6,10-12H2,1-3H3 |
| InChIKey | MAXJKXIUOMWZIT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|