C25H24N2O2 — CID 21136955
2-[(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-N-(2-phenylphenyl)acetamide (PubChem CID 21136955) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-N-(2-phenylphenyl)acetamide.
| Compound Name | 2-[(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-N-(2-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 21136955 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-[(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-N-(2-phenylphenyl)acetamide |
| SMILES | COc1ccc2c(c1)CCC/C2=N\CC(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C25H24N2O2/c1-29-20-14-15-22-19(16-20)10-7-13-23(22)26-17-25(28)27-24-12-6-5-11-21(24)18-8-3-2-4-9-18/h2-6,8-9,11-12,14-16H,7,10,13,17H2,1H3,(H,27,28)/b26-23+ |
| InChIKey | AMEPTHUDMWDIQG-WNAAXNPUSA-N |
| XLogP | 5.13 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|