C13H16N4O4 — CID 21140580
3-[(3,4-dimethyl-1,2-oxazol-5-yl)carbamoylamino]-N-hydroxy-4-methylbenzeneamine oxide (PubChem CID 21140580) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is 3-[(3,4-dimethyl-1,2-oxazol-5-yl)carbamoylamino]-N-hydroxy-4-methylbenzeneamine oxide.
| Compound Name | 3-[(3,4-dimethyl-1,2-oxazol-5-yl)carbamoylamino]-N-hydroxy-4-methylbenzeneamine oxide |
|---|---|
| PubChem CID | 21140580 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-[(3,4-dimethyl-1,2-oxazol-5-yl)carbamoylamino]-N-hydroxy-4-methylbenzeneamine oxide |
| SMILES | Cc1ccc([NH+]([O-])O)cc1NC(=O)Nc1onc(C)c1C |
| InChI | InChI=1S/C13H16N4O4/c1-7-4-5-10(17(19)20)6-11(7)14-13(18)15-12-8(2)9(3)16-21-12/h4-6,17,19H,1-3H3,(H2,14,15,18) |
| InChIKey | YXKPYKUKSQYDMS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 114.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|