About 1-(3,4-dimethyl-1,2-oxazol-5-yl)-3-propylurea
1-(3,4-dimethyl-1,2-oxazol-5-yl)-3-propylurea (PubChem CID 115672493) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-(3,4-dimethyl-1,2-oxazol-5-yl)-3-propylurea.
Molecular Properties
| Compound Name | 1-(3,4-dimethyl-1,2-oxazol-5-yl)-3-propylurea |
| PubChem CID | 115672493 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-(3,4-dimethyl-1,2-oxazol-5-yl)-3-propylurea |
| SMILES | CCCNC(=O)Nc1onc(C)c1C |
| InChI | InChI=1S/C9H15N3O2/c1-4-5-10-9(13)11-8-6(2)7(3)12-14-8/h4-5H2,1-3H3,(H2,10,11,13) |
| InChIKey | VKQGKSOENAVPPY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,4-dimethyl-1,2-oxazol-5-yl)-3-propylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethyl-1,2-oxazol-5-yl)-3-propylurea?
The IUPAC name of 1-(3,4-dimethyl-1,2-oxazol-5-yl)-3-propylurea (CID 115672493) is 1-(3,4-dimethyl-1,2-oxazol-5-yl)-3-propylurea.
What is the SMILES notation for 1-(3,4-dimethyl-1,2-oxazol-5-yl)-3-propylurea?
The canonical SMILES for 1-(3,4-dimethyl-1,2-oxazol-5-yl)-3-propylurea is CCCNC(=O)Nc1onc(C)c1C.
What is the InChIKey of 1-(3,4-dimethyl-1,2-oxazol-5-yl)-3-propylurea?
The InChIKey is VKQGKSOENAVPPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2/c1-4-5-10-9(13)11-8-6(2)7(3)12-14-8/h4-5H2,1-3H3,(H2,10,11,13).
What are the key properties of 1-(3,4-dimethyl-1,2-oxazol-5-yl)-3-propylurea?
1-(3,4-dimethyl-1,2-oxazol-5-yl)-3-propylurea has a molecular weight of 197.24 g/mol, XLogP of 1.82, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethyl-1,2-oxazol-5-yl)-3-propylurea is sourced from PubChem (CID 115672493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).