C12H19N3O4 — CID 70611757
butyl 5-(ethylcarbamoylamino)-3-methyl-1,2-oxazole-4-carboxylate (PubChem CID 70611757) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is butyl 5-(ethylcarbamoylamino)-3-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | butyl 5-(ethylcarbamoylamino)-3-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 70611757 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | butyl 5-(ethylcarbamoylamino)-3-methyl-1,2-oxazole-4-carboxylate |
| SMILES | CCCCOC(=O)c1c(C)noc1NC(=O)NCC |
| InChI | InChI=1S/C12H19N3O4/c1-4-6-7-18-11(16)9-8(3)15-19-10(9)14-12(17)13-5-2/h4-7H2,1-3H3,(H2,13,14,17) |
| InChIKey | XIKNIAVAAWFLCG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|