C13H21N3O4 — CID 70611944
ethyl 5-(butylcarbamoylamino)-3-ethyl-1,2-oxazole-4-carboxylate (PubChem CID 70611944) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is ethyl 5-(butylcarbamoylamino)-3-ethyl-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 5-(butylcarbamoylamino)-3-ethyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 70611944 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | ethyl 5-(butylcarbamoylamino)-3-ethyl-1,2-oxazole-4-carboxylate |
| SMILES | CCCCNC(=O)Nc1onc(CC)c1C(=O)OCC |
| InChI | InChI=1S/C13H21N3O4/c1-4-7-8-14-13(18)15-11-10(12(17)19-6-3)9(5-2)16-20-11/h4-8H2,1-3H3,(H2,14,15,18) |
| InChIKey | JGPVKQADFSCRSC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|