C17H17F2N7O2 — CID 70845189
1-[2-[[4-(2,3-difluorophenyl)-1,3,5-triazin-2-yl]amino]ethyl]-3-(3,4-dimethyl-1,2-oxazol-5-yl)urea (PubChem CID 70845189) has the molecular formula C17H17F2N7O2 and a molecular weight of 389.37 g/mol. Its IUPAC name is 1-[2-[[4-(2,3-difluorophenyl)-1,3,5-triazin-2-yl]amino]ethyl]-3-(3,4-dimethyl-1,2-oxazol-5-yl)urea.
| Compound Name | 1-[2-[[4-(2,3-difluorophenyl)-1,3,5-triazin-2-yl]amino]ethyl]-3-(3,4-dimethyl-1,2-oxazol-5-yl)urea |
|---|---|
| PubChem CID | 70845189 |
| Molecular Formula | C17H17F2N7O2 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 1-[2-[[4-(2,3-difluorophenyl)-1,3,5-triazin-2-yl]amino]ethyl]-3-(3,4-dimethyl-1,2-oxazol-5-yl)urea |
| SMILES | Cc1noc(NC(=O)NCCNc2ncnc(-c3cccc(F)c3F)n2)c1C |
| InChI | InChI=1S/C17H17F2N7O2/c1-9-10(2)26-28-15(9)25-17(27)21-7-6-20-16-23-8-22-14(24-16)11-4-3-5-12(18)13(11)19/h3-5,8H,6-7H2,1-2H3,(H2,21,25,27)(H,20,22,23,24) |
| InChIKey | KXLFOVMJYFFFBA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|