About 4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methylbutanamide
4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methylbutanamide (PubChem CID 80544913) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methylbutanamide.
Molecular Properties
| Compound Name | 4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methylbutanamide |
| PubChem CID | 80544913 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methylbutanamide |
| SMILES | Cc1noc(NC(=O)C(C)CCN)c1C |
| InChI | InChI=1S/C10H17N3O2/c1-6(4-5-11)9(14)12-10-7(2)8(3)13-15-10/h6H,4-5,11H2,1-3H3,(H,12,14) |
| InChIKey | ZLAGJKYLZQIEEL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methylbutanamide?
The IUPAC name of 4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methylbutanamide (CID 80544913) is 4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methylbutanamide.
What is the SMILES notation for 4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methylbutanamide?
The canonical SMILES for 4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methylbutanamide is Cc1noc(NC(=O)C(C)CCN)c1C.
What is the InChIKey of 4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methylbutanamide?
The InChIKey is ZLAGJKYLZQIEEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-6(4-5-11)9(14)12-10-7(2)8(3)13-15-10/h6H,4-5,11H2,1-3H3,(H,12,14).
What are the key properties of 4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methylbutanamide?
4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methylbutanamide has a molecular weight of 211.26 g/mol, XLogP of 1.21, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methylbutanamide is sourced from PubChem (CID 80544913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).