C8H10N2O4 — CID 112617370
methyl 2-[(3,4-dimethyl-1,2-oxazol-5-yl)amino]-2-oxoacetate (PubChem CID 112617370) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is methyl 2-[(3,4-dimethyl-1,2-oxazol-5-yl)amino]-2-oxoacetate.
| Compound Name | methyl 2-[(3,4-dimethyl-1,2-oxazol-5-yl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 112617370 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | methyl 2-[(3,4-dimethyl-1,2-oxazol-5-yl)amino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1onc(C)c1C |
| InChI | InChI=1S/C8H10N2O4/c1-4-5(2)10-14-7(4)9-6(11)8(12)13-3/h1-3H3,(H,9,11) |
| InChIKey | SUYWVQRCUFYGDY-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|