C17H21N2O6S- — CID 21140847
diethyl 4-[5-[hydroxy(oxido)amino]thiophen-2-yl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 21140847) has the molecular formula C17H21N2O6S- and a molecular weight of 381.43 g/mol. Its IUPAC name is diethyl 4-[5-[hydroxy(oxido)amino]thiophen-2-yl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-[5-[hydroxy(oxido)amino]thiophen-2-yl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 21140847 |
| Molecular Formula | C17H21N2O6S- |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | diethyl 4-[5-[hydroxy(oxido)amino]thiophen-2-yl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1ccc(N([O-])O)s1 |
| InChI | InChI=1S/C17H21N2O6S/c1-5-24-16(20)13-9(3)18-10(4)14(17(21)25-6-2)15(13)11-7-8-12(26-11)19(22)23/h7-8,15,18,22H,5-6H2,1-4H3/q-1 |
| InChIKey | GXKXOMMYTOAITQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|