C27H24Cl2N4O4 — CID 21141862
4-[3,5-bis[(3-chlorophenyl)carbamoyl]-2,6-dimethyl-1,4-dihydropyridin-4-yl]-N-hydroxybenzeneamine oxide (PubChem CID 21141862) has the molecular formula C27H24Cl2N4O4 and a molecular weight of 539.42 g/mol. Its IUPAC name is 4-[3,5-bis[(3-chlorophenyl)carbamoyl]-2,6-dimethyl-1,4-dihydropyridin-4-yl]-N-hydroxybenzeneamine oxide.
| Compound Name | 4-[3,5-bis[(3-chlorophenyl)carbamoyl]-2,6-dimethyl-1,4-dihydropyridin-4-yl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 21141862 |
| Molecular Formula | C27H24Cl2N4O4 |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 4-[3,5-bis[(3-chlorophenyl)carbamoyl]-2,6-dimethyl-1,4-dihydropyridin-4-yl]-N-hydroxybenzeneamine oxide |
| SMILES | CC1=C(C(=O)Nc2cccc(Cl)c2)C(c2ccc([NH+]([O-])O)cc2)C(C(=O)Nc2cccc(Cl)c2)=C(C)N1 |
| InChI | InChI=1S/C27H24Cl2N4O4/c1-15-23(26(34)31-20-7-3-5-18(28)13-20)25(17-9-11-22(12-10-17)33(36)37)24(16(2)30-15)27(35)32-21-8-4-6-19(29)14-21/h3-14,25,30,33,36H,1-2H3,(H,31,34)(H,32,35) |
| InChIKey | YFZIVNADFYURHU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 117.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|