About [(4-chlorobenzoyl)amino] 4-[hydroxy(oxido)amino]benzoate
[(4-chlorobenzoyl)amino] 4-[hydroxy(oxido)amino]benzoate (PubChem CID 21141928) has the molecular formula C14H10ClN2O5-
and a molecular weight of 321.70 g/mol. Its IUPAC name is [(4-chlorobenzoyl)amino] 4-[hydroxy(oxido)amino]benzoate.
Molecular Properties
| Compound Name | [(4-chlorobenzoyl)amino] 4-[hydroxy(oxido)amino]benzoate |
| PubChem CID | 21141928 |
| Molecular Formula | C14H10ClN2O5- |
| Molecular Weight | 321.70 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | [(4-chlorobenzoyl)amino] 4-[hydroxy(oxido)amino]benzoate |
| SMILES | O=C(NOC(=O)c1ccc(N([O-])O)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H10ClN2O5/c15-11-5-1-9(2-6-11)13(18)16-22-14(19)10-3-7-12(8-4-10)17(20)21/h1-8,20H,(H,16,18)/q-1 |
| InChIKey | DIXRICFVFMUJGV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.70 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4-chlorobenzoyl)amino] 4-[hydroxy(oxido)amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-chlorobenzoyl)amino] 4-[hydroxy(oxido)amino]benzoate?
The IUPAC name of [(4-chlorobenzoyl)amino] 4-[hydroxy(oxido)amino]benzoate (CID 21141928) is [(4-chlorobenzoyl)amino] 4-[hydroxy(oxido)amino]benzoate.
What is the SMILES notation for [(4-chlorobenzoyl)amino] 4-[hydroxy(oxido)amino]benzoate?
The canonical SMILES for [(4-chlorobenzoyl)amino] 4-[hydroxy(oxido)amino]benzoate is O=C(NOC(=O)c1ccc(N([O-])O)cc1)c1ccc(Cl)cc1.
What is the InChIKey of [(4-chlorobenzoyl)amino] 4-[hydroxy(oxido)amino]benzoate?
The InChIKey is DIXRICFVFMUJGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClN2O5/c15-11-5-1-9(2-6-11)13(18)16-22-14(19)10-3-7-12(8-4-10)17(20)21/h1-8,20H,(H,16,18)/q-1.
What are the key properties of [(4-chlorobenzoyl)amino] 4-[hydroxy(oxido)amino]benzoate?
[(4-chlorobenzoyl)amino] 4-[hydroxy(oxido)amino]benzoate has a molecular weight of 321.70 g/mol, XLogP of 2.54, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-chlorobenzoyl)amino] 4-[hydroxy(oxido)amino]benzoate is sourced from PubChem (CID 21141928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).