About [(4-chlorobenzoyl)amino] 2-chloro-5-nitrobenzoate
[(4-chlorobenzoyl)amino] 2-chloro-5-nitrobenzoate (PubChem CID 2278448) has the molecular formula C14H8Cl2N2O5
and a molecular weight of 355.13 g/mol. Its IUPAC name is [(4-chlorobenzoyl)amino] 2-chloro-5-nitrobenzoate.
Molecular Properties
| Compound Name | [(4-chlorobenzoyl)amino] 2-chloro-5-nitrobenzoate |
| PubChem CID | 2278448 |
| Molecular Formula | C14H8Cl2N2O5 |
| Molecular Weight | 355.13 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | [(4-chlorobenzoyl)amino] 2-chloro-5-nitrobenzoate |
| SMILES | O=C(NOC(=O)c1cc([N+](=O)[O-])ccc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H8Cl2N2O5/c15-9-3-1-8(2-4-9)13(19)17-23-14(20)11-7-10(18(21)22)5-6-12(11)16/h1-7H,(H,17,19) |
| InChIKey | RJCQRLYGNCTRFI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.13 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4-chlorobenzoyl)amino] 2-chloro-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-chlorobenzoyl)amino] 2-chloro-5-nitrobenzoate?
The IUPAC name of [(4-chlorobenzoyl)amino] 2-chloro-5-nitrobenzoate (CID 2278448) is [(4-chlorobenzoyl)amino] 2-chloro-5-nitrobenzoate.
What is the SMILES notation for [(4-chlorobenzoyl)amino] 2-chloro-5-nitrobenzoate?
The canonical SMILES for [(4-chlorobenzoyl)amino] 2-chloro-5-nitrobenzoate is O=C(NOC(=O)c1cc([N+](=O)[O-])ccc1Cl)c1ccc(Cl)cc1.
What is the InChIKey of [(4-chlorobenzoyl)amino] 2-chloro-5-nitrobenzoate?
The InChIKey is RJCQRLYGNCTRFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2N2O5/c15-9-3-1-8(2-4-9)13(19)17-23-14(20)11-7-10(18(21)22)5-6-12(11)16/h1-7H,(H,17,19).
What are the key properties of [(4-chlorobenzoyl)amino] 2-chloro-5-nitrobenzoate?
[(4-chlorobenzoyl)amino] 2-chloro-5-nitrobenzoate has a molecular weight of 355.13 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-chlorobenzoyl)amino] 2-chloro-5-nitrobenzoate is sourced from PubChem (CID 2278448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).