C10H17ClN4O3 — CID 21141972
2-[2-(dimethylamino)ethylcarbamoyl]-N-hydroxypyridin-4-amine oxide;hydrochloride (PubChem CID 21141972) has the molecular formula C10H17ClN4O3 and a molecular weight of 276.72 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylcarbamoyl]-N-hydroxypyridin-4-amine oxide;hydrochloride.
| Compound Name | 2-[2-(dimethylamino)ethylcarbamoyl]-N-hydroxypyridin-4-amine oxide;hydrochloride |
|---|---|
| PubChem CID | 21141972 |
| Molecular Formula | C10H17ClN4O3 |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-[2-(dimethylamino)ethylcarbamoyl]-N-hydroxypyridin-4-amine oxide;hydrochloride |
| SMILES | CN(C)CCNC(=O)c1cc([NH+]([O-])O)ccn1.Cl |
| InChI | InChI=1S/C10H16N4O3.ClH/c1-13(2)6-5-12-10(15)9-7-8(14(16)17)3-4-11-9;/h3-4,7,14,16H,5-6H2,1-2H3,(H,12,15);1H |
| InChIKey | YIZUQVDIPDANIU-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|