C22H20N2O6S — CID 21144020
4-[(2,7-dimethoxyacridin-9-yl)sulfonylmethyl]-N-hydroxybenzeneamine oxide (PubChem CID 21144020) has the molecular formula C22H20N2O6S and a molecular weight of 440.48 g/mol. Its IUPAC name is 4-[(2,7-dimethoxyacridin-9-yl)sulfonylmethyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 4-[(2,7-dimethoxyacridin-9-yl)sulfonylmethyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 21144020 |
| Molecular Formula | C22H20N2O6S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 4-[(2,7-dimethoxyacridin-9-yl)sulfonylmethyl]-N-hydroxybenzeneamine oxide |
| SMILES | COc1ccc2nc3ccc(OC)cc3c(S(=O)(=O)Cc3ccc([NH+]([O-])O)cc3)c2c1 |
| InChI | InChI=1S/C22H20N2O6S/c1-29-16-7-9-20-18(11-16)22(19-12-17(30-2)8-10-21(19)23-20)31(27,28)13-14-3-5-15(6-4-14)24(25)26/h3-12,24-25H,13H2,1-2H3 |
| InChIKey | LCSVBADQIBPXDU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|