C25H42ClN3O2 — CID 21144606
2,8-dibutyl-4-(4-ethoxyphenyl)-6,6,7,7-tetramethyl-2,4,8-triazabicyclo[3.2.1]octan-3-one;hydrochloride (PubChem CID 21144606) has the molecular formula C25H42ClN3O2 and a molecular weight of 452.08 g/mol. Its IUPAC name is 2,8-dibutyl-4-(4-ethoxyphenyl)-6,6,7,7-tetramethyl-2,4,8-triazabicyclo[3.2.1]octan-3-one;hydrochloride.
| Compound Name | 2,8-dibutyl-4-(4-ethoxyphenyl)-6,6,7,7-tetramethyl-2,4,8-triazabicyclo[3.2.1]octan-3-one;hydrochloride |
|---|---|
| PubChem CID | 21144606 |
| Molecular Formula | C25H42ClN3O2 |
| Molecular Weight | 452.08 g/mol |
| Exact Mass | 451.30 |
| IUPAC Name | 2,8-dibutyl-4-(4-ethoxyphenyl)-6,6,7,7-tetramethyl-2,4,8-triazabicyclo[3.2.1]octan-3-one;hydrochloride |
| SMILES | CCCCN1C(=O)N(c2ccc(OCC)cc2)C2N(CCCC)C1C(C)(C)C2(C)C.Cl |
| InChI | InChI=1S/C25H41N3O2.ClH/c1-8-11-17-26-21-24(4,5)25(6,7)22(26)28(23(29)27(21)18-12-9-2)19-13-15-20(16-14-19)30-10-3;/h13-16,21-22H,8-12,17-18H2,1-7H3;1H |
| InChIKey | FZKVRRCIKUPNMC-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.08 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |