C13H14ClN5O6 — CID 21145662
5-chloro-1-[(2R,5S)-5-(hydroxymethyl)-4-(2-methyl-4-nitroimidazol-1-yl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 21145662) has the molecular formula C13H14ClN5O6 and a molecular weight of 371.74 g/mol. Its IUPAC name is 5-chloro-1-[(2R,5S)-5-(hydroxymethyl)-4-(2-methyl-4-nitroimidazol-1-yl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-chloro-1-[(2R,5S)-5-(hydroxymethyl)-4-(2-methyl-4-nitroimidazol-1-yl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 21145662 |
| Molecular Formula | C13H14ClN5O6 |
| Molecular Weight | 371.74 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 5-chloro-1-[(2R,5S)-5-(hydroxymethyl)-4-(2-methyl-4-nitroimidazol-1-yl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1nc([N+](=O)[O-])cn1C1C[C@H](n2cc(Cl)c(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C13H14ClN5O6/c1-6-15-10(19(23)24)4-17(6)8-2-11(25-9(8)5-20)18-3-7(14)12(21)16-13(18)22/h3-4,8-9,11,20H,2,5H2,1H3,(H,16,21,22)/t8?,9-,11-/m1/s1 |
| InChIKey | SVZJGTXQXLFMNW-HOGWDWRMSA-N |
| XLogP | 0.12 |
| TPSA | 145.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.74 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|