C16H17N2O9P — CID 21147965
[4-(2,4-dioxopyrimidin-1-yl)-6-(hydroxymethyl)-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-2-yl]phosphonic acid (PubChem CID 21147965) has the molecular formula C16H17N2O9P and a molecular weight of 412.29 g/mol. Its IUPAC name is [4-(2,4-dioxopyrimidin-1-yl)-6-(hydroxymethyl)-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-2-yl]phosphonic acid.
| Compound Name | [4-(2,4-dioxopyrimidin-1-yl)-6-(hydroxymethyl)-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 21147965 |
| Molecular Formula | C16H17N2O9P |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | [4-(2,4-dioxopyrimidin-1-yl)-6-(hydroxymethyl)-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-2-yl]phosphonic acid |
| SMILES | O=c1ccn(C2OC(CO)C3OC(c4ccccc4)(P(=O)(O)O)OC32)c(=O)[nH]1 |
| InChI | InChI=1S/C16H17N2O9P/c19-8-10-12-13(14(25-10)18-7-6-11(20)17-15(18)21)27-16(26-12,28(22,23)24)9-4-2-1-3-5-9/h1-7,10,12-14,19H,8H2,(H,17,20,21)(H2,22,23,24) |
| InChIKey | OKUUSHJRFGJSML-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 160.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|