C11H12N2O3S2 — CID 21148233
2-(acetylcarbamothioylamino)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid (PubChem CID 21148233) has the molecular formula C11H12N2O3S2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-(acetylcarbamothioylamino)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid.
| Compound Name | 2-(acetylcarbamothioylamino)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 21148233 |
| Molecular Formula | C11H12N2O3S2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 2-(acetylcarbamothioylamino)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid |
| SMILES | CC(=O)NC(=S)Nc1sc2c(c1C(=O)O)CCC2 |
| InChI | InChI=1S/C11H12N2O3S2/c1-5(14)12-11(17)13-9-8(10(15)16)6-3-2-4-7(6)18-9/h2-4H2,1H3,(H,15,16)(H2,12,13,14,17) |
| InChIKey | BVDIWIRZDSCCQT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|