C22H24N2O2 — CID 21148418
2-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-1-pyridin-3-ylethanamine (PubChem CID 21148418) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-1-pyridin-3-ylethanamine.
| Compound Name | 2-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-1-pyridin-3-ylethanamine |
|---|---|
| PubChem CID | 21148418 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-1-pyridin-3-ylethanamine |
| SMILES | COc1cc(CC(N)c2cccnc2)ccc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C22H24N2O2/c1-16-5-3-6-18(11-16)15-26-21-9-8-17(13-22(21)25-2)12-20(23)19-7-4-10-24-14-19/h3-11,13-14,20H,12,15,23H2,1-2H3 |
| InChIKey | KWWWVMHAVXBONN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |