About N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2-thiophen-2-ylethyl)methanetriamine
N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2-thiophen-2-ylethyl)methanetriamine (PubChem CID 21149282) has the molecular formula C13H19N5S
and a molecular weight of 277.40 g/mol. Its IUPAC name is N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2-thiophen-2-ylethyl)methanetriamine.
Molecular Properties
| Compound Name | N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2-thiophen-2-ylethyl)methanetriamine |
| PubChem CID | 21149282 |
| Molecular Formula | C13H19N5S |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2-thiophen-2-ylethyl)methanetriamine |
| SMILES | Cc1cc(C)nc(NC(N)NCCc2cccs2)n1 |
| InChI | InChI=1S/C13H19N5S/c1-9-8-10(2)17-13(16-9)18-12(14)15-6-5-11-4-3-7-19-11/h3-4,7-8,12,15H,5-6,14H2,1-2H3,(H,16,17,18) |
| InChIKey | HHAYAOLUPMSNSB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2-thiophen-2-ylethyl)methanetriamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2-thiophen-2-ylethyl)methanetriamine?
The IUPAC name of N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2-thiophen-2-ylethyl)methanetriamine (CID 21149282) is N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2-thiophen-2-ylethyl)methanetriamine.
What is the SMILES notation for N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2-thiophen-2-ylethyl)methanetriamine?
The canonical SMILES for N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2-thiophen-2-ylethyl)methanetriamine is Cc1cc(C)nc(NC(N)NCCc2cccs2)n1.
What is the InChIKey of N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2-thiophen-2-ylethyl)methanetriamine?
The InChIKey is HHAYAOLUPMSNSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5S/c1-9-8-10(2)17-13(16-9)18-12(14)15-6-5-11-4-3-7-19-11/h3-4,7-8,12,15H,5-6,14H2,1-2H3,(H,16,17,18).
What are the key properties of N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2-thiophen-2-ylethyl)methanetriamine?
N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2-thiophen-2-ylethyl)methanetriamine has a molecular weight of 277.40 g/mol, XLogP of 1.64, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2-thiophen-2-ylethyl)methanetriamine is sourced from PubChem (CID 21149282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).