C15H13N2O6S- — CID 21149986
2-[[2-[(4-hydroxyphenyl)sulfonylamino]benzoyl]amino]acetate (PubChem CID 21149986) has the molecular formula C15H13N2O6S- and a molecular weight of 349.34 g/mol. Its IUPAC name is 2-[[2-[(4-hydroxyphenyl)sulfonylamino]benzoyl]amino]acetate.
| Compound Name | 2-[[2-[(4-hydroxyphenyl)sulfonylamino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 21149986 |
| Molecular Formula | C15H13N2O6S- |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 2-[[2-[(4-hydroxyphenyl)sulfonylamino]benzoyl]amino]acetate |
| SMILES | O=C([O-])CNC(=O)c1ccccc1NS(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H14N2O6S/c18-10-5-7-11(8-6-10)24(22,23)17-13-4-2-1-3-12(13)15(21)16-9-14(19)20/h1-8,17-18H,9H2,(H,16,21)(H,19,20)/p-1 |
| InChIKey | QBMYNMQQDCMRPR-UHFFFAOYSA-M |
| XLogP | -0.33 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |