About naphthalen-1-yl dihydrogen phosphate
naphthalen-1-yl dihydrogen phosphate (PubChem CID 2115) has the molecular formula C10H9O4P
and a molecular weight of 224.15 g/mol. Its IUPAC name is naphthalen-1-yl dihydrogen phosphate.
Molecular Properties
| Compound Name | naphthalen-1-yl dihydrogen phosphate |
| PubChem CID | 2115 |
| Molecular Formula | C10H9O4P |
| Molecular Weight | 224.15 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | naphthalen-1-yl dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C10H9O4P/c11-15(12,13)14-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H2,11,12,13) |
| InChIKey | YNXICDMQCQPQEW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.15 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-yl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-yl dihydrogen phosphate?
The IUPAC name of naphthalen-1-yl dihydrogen phosphate (CID 2115) is naphthalen-1-yl dihydrogen phosphate.
What is the SMILES notation for naphthalen-1-yl dihydrogen phosphate?
The canonical SMILES for naphthalen-1-yl dihydrogen phosphate is O=P(O)(O)Oc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-yl dihydrogen phosphate?
The InChIKey is YNXICDMQCQPQEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9O4P/c11-15(12,13)14-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H2,11,12,13).
What are the key properties of naphthalen-1-yl dihydrogen phosphate?
naphthalen-1-yl dihydrogen phosphate has a molecular weight of 224.15 g/mol, XLogP of 2.31, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-yl dihydrogen phosphate is sourced from PubChem (CID 2115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).