C28H44N4O7S — CID 21150343
N,N'-bis[5-(4-aminophenoxy)pentyl]pentanediamide;methanesulfonic acid (PubChem CID 21150343) has the molecular formula C28H44N4O7S and a molecular weight of 580.75 g/mol. Its IUPAC name is N,N'-bis[5-(4-aminophenoxy)pentyl]pentanediamide;methanesulfonic acid.
| Compound Name | N,N'-bis[5-(4-aminophenoxy)pentyl]pentanediamide;methanesulfonic acid |
|---|---|
| PubChem CID | 21150343 |
| Molecular Formula | C28H44N4O7S |
| Molecular Weight | 580.75 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | N,N'-bis[5-(4-aminophenoxy)pentyl]pentanediamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Nc1ccc(OCCCCCNC(=O)CCCC(=O)NCCCCCOc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C27H40N4O4.CH4O3S/c28-22-10-14-24(15-11-22)34-20-5-1-3-18-30-26(32)8-7-9-27(33)31-19-4-2-6-21-35-25-16-12-23(29)13-17-25;1-5(2,3)4/h10-17H,1-9,18-21,28-29H2,(H,30,32)(H,31,33);1H3,(H,2,3,4) |
| InChIKey | WCDCBCJCFISIPZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 183.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.75 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|