C16H26N2O7S — CID 20833927
ethyl 2-[5-(4-aminophenoxy)pentylamino]-2-oxoacetate;methanesulfonic acid (PubChem CID 20833927) has the molecular formula C16H26N2O7S and a molecular weight of 390.46 g/mol. Its IUPAC name is ethyl 2-[5-(4-aminophenoxy)pentylamino]-2-oxoacetate;methanesulfonic acid.
| Compound Name | ethyl 2-[5-(4-aminophenoxy)pentylamino]-2-oxoacetate;methanesulfonic acid |
|---|---|
| PubChem CID | 20833927 |
| Molecular Formula | C16H26N2O7S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | ethyl 2-[5-(4-aminophenoxy)pentylamino]-2-oxoacetate;methanesulfonic acid |
| SMILES | CCOC(=O)C(=O)NCCCCCOc1ccc(N)cc1.CS(=O)(=O)O |
| InChI | InChI=1S/C15H22N2O4.CH4O3S/c1-2-20-15(19)14(18)17-10-4-3-5-11-21-13-8-6-12(16)7-9-13;1-5(2,3)4/h6-9H,2-5,10-11,16H2,1H3,(H,17,18);1H3,(H,2,3,4) |
| InChIKey | CJPDBSXVFUNKIM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|