C22H30O8 — CID 21150894
[6-(acetyloxymethyl)-3-(3-methylbutanoyloxy)spiro[3a,4-dihydro-3H-1-benzofuran-2,2'-oxirane]-4-yl] 3-methylbutanoate (PubChem CID 21150894) has the molecular formula C22H30O8 and a molecular weight of 422.47 g/mol. Its IUPAC name is [6-(acetyloxymethyl)-3-(3-methylbutanoyloxy)spiro[3a,4-dihydro-3H-1-benzofuran-2,2'-oxirane]-4-yl] 3-methylbutanoate.
| Compound Name | [6-(acetyloxymethyl)-3-(3-methylbutanoyloxy)spiro[3a,4-dihydro-3H-1-benzofuran-2,2'-oxirane]-4-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 21150894 |
| Molecular Formula | C22H30O8 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | [6-(acetyloxymethyl)-3-(3-methylbutanoyloxy)spiro[3a,4-dihydro-3H-1-benzofuran-2,2'-oxirane]-4-yl] 3-methylbutanoate |
| SMILES | CC(=O)OCC1=CC(OC(=O)CC(C)C)C2C(=C1)OC1(CO1)C2OC(=O)CC(C)C |
| InChI | InChI=1S/C22H30O8/c1-12(2)6-18(24)28-16-8-15(10-26-14(5)23)9-17-20(16)21(22(30-17)11-27-22)29-19(25)7-13(3)4/h8-9,12-13,16,20-21H,6-7,10-11H2,1-5H3 |
| InChIKey | YHASTKXIRLGHPD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 100.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|