C13H20N4O2 — CID 21152033
1-[(3,4-dimethoxyphenyl)methyl]-1-(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazine (PubChem CID 21152033) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-1-(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazine.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-1-(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazine |
|---|---|
| PubChem CID | 21152033 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-1-(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazine |
| SMILES | COc1ccc(CN(N)C2=NCCCN2)cc1OC |
| InChI | InChI=1S/C13H20N4O2/c1-18-11-5-4-10(8-12(11)19-2)9-17(14)13-15-6-3-7-16-13/h4-5,8H,3,6-7,9,14H2,1-2H3,(H,15,16) |
| InChIKey | NQOIMQNMISONLT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|