C16H26N4O2 — CID 110913670
1-(3,4-dimethoxyphenyl)-N,N-dimethyl-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)ethane-1,2-diamine (PubChem CID 110913670) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N,N-dimethyl-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)ethane-1,2-diamine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N,N-dimethyl-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 110913670 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N,N-dimethyl-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)ethane-1,2-diamine |
| SMILES | COc1ccc(C(CNC2=NCCCN2)N(C)C)cc1OC |
| InChI | InChI=1S/C16H26N4O2/c1-20(2)13(11-19-16-17-8-5-9-18-16)12-6-7-14(21-3)15(10-12)22-4/h6-7,10,13H,5,8-9,11H2,1-4H3,(H2,17,18,19) |
| InChIKey | AVRMUFSAILJHLE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |