C14H24N4S — CID 110915302
N,N-diethyl-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-thiophen-3-ylethane-1,2-diamine (PubChem CID 110915302) has the molecular formula C14H24N4S and a molecular weight of 280.44 g/mol. Its IUPAC name is N,N-diethyl-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-thiophen-3-ylethane-1,2-diamine.
| Compound Name | N,N-diethyl-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-thiophen-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 110915302 |
| Molecular Formula | C14H24N4S |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | N,N-diethyl-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-thiophen-3-ylethane-1,2-diamine |
| SMILES | CCN(CC)C(CNC1=NCCCN1)c1ccsc1 |
| InChI | InChI=1S/C14H24N4S/c1-3-18(4-2)13(12-6-9-19-11-12)10-17-14-15-7-5-8-16-14/h6,9,11,13H,3-5,7-8,10H2,1-2H3,(H2,15,16,17) |
| InChIKey | VBSYFMARBVDMKA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |