C16H26ClIN4 — CID 75418967
1-(2-chlorophenyl)-N,N-diethyl-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)ethane-1,2-diamine;hydroiodide (PubChem CID 75418967) has the molecular formula C16H26ClIN4 and a molecular weight of 436.77 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N,N-diethyl-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)ethane-1,2-diamine;hydroiodide.
| Compound Name | 1-(2-chlorophenyl)-N,N-diethyl-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)ethane-1,2-diamine;hydroiodide |
|---|---|
| PubChem CID | 75418967 |
| Molecular Formula | C16H26ClIN4 |
| Molecular Weight | 436.77 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 1-(2-chlorophenyl)-N,N-diethyl-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)ethane-1,2-diamine;hydroiodide |
| SMILES | CCN(CC)C(CNC1=NCCCN1)c1ccccc1Cl.I |
| InChI | InChI=1S/C16H25ClN4.HI/c1-3-21(4-2)15(13-8-5-6-9-14(13)17)12-20-16-18-10-7-11-19-16;/h5-6,8-9,15H,3-4,7,10-12H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | MJIBUXNHKXASNT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.77 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|