C20H35ClN2 — CID 110827062
1-(2-chlorophenyl)-N,N-diethyl-N'-octylethane-1,2-diamine (PubChem CID 110827062) has the molecular formula C20H35ClN2 and a molecular weight of 338.97 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N,N-diethyl-N'-octylethane-1,2-diamine.
| Compound Name | 1-(2-chlorophenyl)-N,N-diethyl-N'-octylethane-1,2-diamine |
|---|---|
| PubChem CID | 110827062 |
| Molecular Formula | C20H35ClN2 |
| Molecular Weight | 338.97 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 1-(2-chlorophenyl)-N,N-diethyl-N'-octylethane-1,2-diamine |
| SMILES | CCCCCCCCNCC(c1ccccc1Cl)N(CC)CC |
| InChI | InChI=1S/C20H35ClN2/c1-4-7-8-9-10-13-16-22-17-20(23(5-2)6-3)18-14-11-12-15-19(18)21/h11-12,14-15,20,22H,4-10,13,16-17H2,1-3H3 |
| InChIKey | DATNRUFLTTWKPY-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.97 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|