C16H21ClN2O2S2 — CID 26192906
N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]thiophene-2-sulfonamide (PubChem CID 26192906) has the molecular formula C16H21ClN2O2S2 and a molecular weight of 372.94 g/mol. Its IUPAC name is N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 26192906 |
| Molecular Formula | C16H21ClN2O2S2 |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]thiophene-2-sulfonamide |
| SMILES | CCN(CC)[C@@H](CNS(=O)(=O)c1cccs1)c1ccccc1Cl |
| InChI | InChI=1S/C16H21ClN2O2S2/c1-3-19(4-2)15(13-8-5-6-9-14(13)17)12-18-23(20,21)16-10-7-11-22-16/h5-11,15,18H,3-4,12H2,1-2H3/t15-/m0/s1 |
| InChIKey | PQMFBTNNUXNYNT-HNNXBMFYSA-N |
| XLogP | 3.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |