C17H29ClN2O3S — CID 97349330
(2R)-N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-methoxybutane-2-sulfonamide (PubChem CID 97349330) has the molecular formula C17H29ClN2O3S and a molecular weight of 376.95 g/mol. Its IUPAC name is (2R)-N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-methoxybutane-2-sulfonamide.
| Compound Name | (2R)-N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-methoxybutane-2-sulfonamide |
|---|---|
| PubChem CID | 97349330 |
| Molecular Formula | C17H29ClN2O3S |
| Molecular Weight | 376.95 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (2R)-N-[(2R)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-methoxybutane-2-sulfonamide |
| SMILES | CCN(CC)[C@@H](CNS(=O)(=O)[C@H](C)CCOC)c1ccccc1Cl |
| InChI | InChI=1S/C17H29ClN2O3S/c1-5-20(6-2)17(15-9-7-8-10-16(15)18)13-19-24(21,22)14(3)11-12-23-4/h7-10,14,17,19H,5-6,11-13H2,1-4H3/t14-,17+/m1/s1 |
| InChIKey | MWLDDNNOMPEXDF-PBHICJAKSA-N |
| XLogP | 3.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.95 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |