C21H29ClN2O4S — CID 43062063
N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-(2-methoxyethoxy)benzenesulfonamide (PubChem CID 43062063) has the molecular formula C21H29ClN2O4S and a molecular weight of 440.99 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-(2-methoxyethoxy)benzenesulfonamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-(2-methoxyethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 43062063 |
| Molecular Formula | C21H29ClN2O4S |
| Molecular Weight | 440.99 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-(2-methoxyethoxy)benzenesulfonamide |
| SMILES | CCN(CC)C(CNS(=O)(=O)c1ccc(OCCOC)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C21H29ClN2O4S/c1-4-24(5-2)21(19-8-6-7-9-20(19)22)16-23-29(25,26)18-12-10-17(11-13-18)28-15-14-27-3/h6-13,21,23H,4-5,14-16H2,1-3H3 |
| InChIKey | VDBXLMMVJLNRHO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.99 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|