C19H25NO5S — CID 71846532
N-(2-benzyl-3-hydroxypropyl)-4-(2-methoxyethoxy)benzenesulfonamide (PubChem CID 71846532) has the molecular formula C19H25NO5S and a molecular weight of 379.48 g/mol. Its IUPAC name is N-(2-benzyl-3-hydroxypropyl)-4-(2-methoxyethoxy)benzenesulfonamide.
| Compound Name | N-(2-benzyl-3-hydroxypropyl)-4-(2-methoxyethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 71846532 |
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-(2-benzyl-3-hydroxypropyl)-4-(2-methoxyethoxy)benzenesulfonamide |
| SMILES | COCCOc1ccc(S(=O)(=O)NCC(CO)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C19H25NO5S/c1-24-11-12-25-18-7-9-19(10-8-18)26(22,23)20-14-17(15-21)13-16-5-3-2-4-6-16/h2-10,17,20-21H,11-15H2,1H3 |
| InChIKey | UGMWILHIWPFDBV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|