C18H21NO5S — CID 96999453
methyl 4-[[(2S)-2-benzyl-3-hydroxypropyl]sulfamoyl]benzoate (PubChem CID 96999453) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is methyl 4-[[(2S)-2-benzyl-3-hydroxypropyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-[[(2S)-2-benzyl-3-hydroxypropyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 96999453 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | methyl 4-[[(2S)-2-benzyl-3-hydroxypropyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NC[C@@H](CO)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21NO5S/c1-24-18(21)16-7-9-17(10-8-16)25(22,23)19-12-15(13-20)11-14-5-3-2-4-6-14/h2-10,15,19-20H,11-13H2,1H3/t15-/m0/s1 |
| InChIKey | YDYYVPQIAWKFLS-HNNXBMFYSA-N |
| XLogP | 1.60 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |