C19H24ClN3O5S — CID 16960227
N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-methoxy-3-nitrobenzenesulfonamide (PubChem CID 16960227) has the molecular formula C19H24ClN3O5S and a molecular weight of 441.94 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-methoxy-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-methoxy-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 16960227 |
| Molecular Formula | C19H24ClN3O5S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-4-methoxy-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)C(CNS(=O)(=O)c1ccc(OC)c([N+](=O)[O-])c1)c1ccccc1Cl |
| InChI | InChI=1S/C19H24ClN3O5S/c1-4-22(5-2)18(15-8-6-7-9-16(15)20)13-21-29(26,27)14-10-11-19(28-3)17(12-14)23(24)25/h6-12,18,21H,4-5,13H2,1-3H3 |
| InChIKey | CBHBAVJFOPFYOU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|