C17H20ClN3O5S — CID 55511699
N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-4-methoxy-2-nitrobenzenesulfonamide (PubChem CID 55511699) has the molecular formula C17H20ClN3O5S and a molecular weight of 413.88 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-4-methoxy-2-nitrobenzenesulfonamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-4-methoxy-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55511699 |
| Molecular Formula | C17H20ClN3O5S |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-4-methoxy-2-nitrobenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(c2ccccc2Cl)N(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H20ClN3O5S/c1-20(2)16(13-6-4-5-7-14(13)18)11-19-27(24,25)17-9-8-12(26-3)10-15(17)21(22)23/h4-10,16,19H,11H2,1-3H3 |
| InChIKey | AWZJPLHGVZGKAV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|